Data

Copy and paste the text below. It is read-only. Select All

metabolism the sum of all chemical reactions in an organism Heterotrophs another word for consumer glucose the most important sugar involved in cellular respiration adenine, 3 phosphates, ribose three main parts of ATP polymer a combonation of two or more monomers hydrophylic means water loving kinetic, potential 2 main energy's in biology carbon essential element of life carbs, proteins, lipids, nucleic acids 4 main polymers important in biology denaturation the process where proteins have lost their shape enzyme a protein that acts as a catalyst Hans Kreb a scientist in the 1930's who discovered an important part of cellular respiration photosynthesis a process that requires O glycosis, electron transport, krebs cycle the three main parts of cellular respiration Acetyl co-A something that becomes something when pyruvic acid loses carbon dioxide diffusion a type of passive transport that allows pyruvic acid to enter the mitochondria organic a compound that contains C glycosis a part of cellular respiration that occurs in the cytoplasm ETC the part of cellular respiration that involves the pumping of H ions Hydroxyl, Carbonyl, Carboxyl, Amino Group four functional groups lipids the polymer that is hydrophobic CH(2)O the basic formula for any carbohydrate decarboxylation the process of losing carbon dioxide during the Krebs Cycle mitochondria the part of the cell that most cellular respiration occurs autotrophs organisms that make their own food 20 number of different amino acids dehydration the type of reaction that is used to make proteins ATP the main energy that is used by organisms kinetic energy of motion lactic acid fermentation the anaerobic process that sometimes takes place instead of glycosis CO(2)H(2)O+sun=C(6)H(12)O(6)O(2) the complete formula for the reaction of photosynthesis activation energy energy to start a chemical reaction starch, cellulose two examples of polysaccharides amino group, carboxyll, hydrogen, side group the four partners that C is bonded to the form an amino acid Explain the process of glycosis glucose is turned into 2 pyruvic acids which then produces 4 ATP's but 2 are used during the process so 2 ATP's at the end are only produced. It happens in the cytoplasm