Ch 5 & 7 (Questions from the Test, Vocab)

Love him
STUDY
PLAY
metabolism
the sum of all chemical reactions in an organism
Heterotrophs
another word for consumer
glucose
the most important sugar involved in cellular respiration
adenine, 3 phosphates, ribose
three main parts of ATP
polymer
a combonation of two or more monomers
hydrophylic
means water loving
kinetic, potential
2 main energy's in biology
carbon
essential element of life
carbs, proteins, lipids, nucleic acids
4 main polymers important in biology
denaturation
the process where proteins have lost their shape
enzyme
a protein that acts as a catalyst
Hans Kreb
a scientist in the 1930's who discovered an important part of cellular respiration
photosynthesis
a process that requires O
glycosis, electron transport, krebs cycle
the three main parts of cellular respiration
Acetyl co-A
something that becomes something when pyruvic acid loses carbon dioxide
diffusion
a type of passive transport that allows pyruvic acid to enter the mitochondria
organic
a compound that contains C
glycosis
a part of cellular respiration that occurs in the cytoplasm
ETC
the part of cellular respiration that involves the pumping of H ions
Hydroxyl, Carbonyl, Carboxyl, Amino Group
four functional groups
lipids
the polymer that is hydrophobic
CH(2)O
the basic formula for any carbohydrate
decarboxylation
the process of losing carbon dioxide during the Krebs Cycle
mitochondria
the part of the cell that most cellular respiration occurs
autotrophs
organisms that make their own food
20
number of different amino acids
dehydration
the type of reaction that is used to make proteins
ATP
the main energy that is used by organisms
kinetic
energy of motion
lactic acid fermentation
the anaerobic process that sometimes takes place instead of glycosis
CO(2)H(2)O+sun=C(6)H(12)O(6)O(2)
the complete formula for the reaction of photosynthesis
activation energy
energy to start a chemical reaction
starch, cellulose
two examples of polysaccharides
amino group, carboxyll, hydrogen, side group
the four partners that C is bonded to the form an amino acid
Explain the process of glycosis
glucose is turned into 2 pyruvic acids which then produces 4 ATP's but 2 are used during the process so 2 ATP's at the end are only produced. It happens in the cytoplasm