Write equations showing the oxidation of a primary alcohol and the oxidation of a secondary alcohol to produce an aldehyde and a ketone, respectively. Indicate the structure of each alcohol and of the principal organic products of the oxidations.

Name the two coenzymes involved in glucose oxidation and the general role that they have in common.

Write a balanced chemical equation for the combustion of cyclohexane.

To answer, researchers would measure two variables for each individual unit in the study. In each case, specify the two variables, and the variable type for each. Then, specify which is the explanatory variable and which is the response variable. For college students, is there a relationship between grade point average (GPA) and average number of hours spent studying each week? Individuals in the United States fall into one of a small number of tax brackets based on level of income. Is there a relationship between a person's tax bracket and the percent of income donated to charities?

Aldehydes and ketones can be named in a systematic way by counting the number of carbon atoms (including the carbonyl carbon) that they contain. The name of the aldehyde or ketone is based on the hydrocarbon with the same number of carbon atoms. The ending -al for aldehyde or -one for ketone is added as appropriate. Draw the structural formulas for the following aldehydes or ketones: 2-methylbutanal

Use molecular structure to explain the following:

(a) Fructose is a ketone.
(b) Glucose is an aldehyde.

Mention some commercial uses of specific aldehydes and ketones .

What structural feature distinguishes aldehydes from ketones ?

What two products are formed when a hydrocarbon (a substance containing only the elements hydrogen and carbon) undergoes complete combustion in oxygen gas?

The following are named incorrectly, but a correct structure can be made from the name given. Draw the following incorrectly named compounds and name them correctly.
a. 2-ethyl-3-methyl-5-isopropyl hexane
b. 3-methyl-4-isopropylpentane
c. 2-ethyl-3-butyne

Draw the following incorrectly named compounds and name them correctly. a. 2-ethyl-3-methyl-5-isopropylhexane b. 2-ethyl-4-tert-butylpentane c. 3-methyl-4-isopropylpentane d. 2-ethyl-3-butyne

Write the correct names of the following alkanes:

a. $\ce{CH3-CH2-CH3}$

b. $\ce{CH3-CH2-CH(CH3)-CH(CH3)-CH3}$

c. $\ce{CH3-CH(CH3)-CH(CH3)-CH3}$

Draw the structure of 2-butanol. Identify the chiral carbon atom in this compound. Draw the mirror image of the structure you first drew. Are the two molecules superimposable?

What functional group is common to both aldehydes and ketones ?